About 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide
4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide (PubChem CID 59810771) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide |
| PubChem CID | 59810771 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide |
| SMILES | CCc1c(C)nc2ccc(C(=O)NC)cc2c1Cl |
| InChI | InChI=1S/C14H15ClN2O/c1-4-10-8(2)17-12-6-5-9(14(18)16-3)7-11(12)13(10)15/h5-7H,4H2,1-3H3,(H,16,18) |
| InChIKey | IMHCQFIRJJGQJH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide?
The IUPAC name of 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide (CID 59810771) is 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide.
What is the SMILES notation for 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide?
The canonical SMILES for 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide is CCc1c(C)nc2ccc(C(=O)NC)cc2c1Cl.
What is the InChIKey of 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide?
The InChIKey is IMHCQFIRJJGQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O/c1-4-10-8(2)17-12-6-5-9(14(18)16-3)7-11(12)13(10)15/h5-7H,4H2,1-3H3,(H,16,18).
What are the key properties of 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide?
4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide has a molecular weight of 262.74 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-ethyl-N,2-dimethylquinoline-6-carboxamide is sourced from PubChem (CID 59810771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).