About [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine
[amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine (PubChem CID 170842941) has the molecular formula C3H14N6O3+2
and a molecular weight of 182.18 g/mol. Its IUPAC name is [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine.
Molecular Properties
| Compound Name | [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine |
| PubChem CID | 170842941 |
| Molecular Formula | C3H14N6O3+2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine |
| SMILES | NC(=[NH2+])[NH3+].O=C(O)O.[H]N=C(N)N |
| InChI | InChI=1S/2CH5N3.CH2O3/c3*2-1(3)4/h2*(H5,2,3,4);(H2,2,3,4)/p+2 |
| InChIKey | STIAPHVBRDNOAJ-UHFFFAOYSA-P |
| XLogP | -4.64 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine?
The IUPAC name of [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine (CID 170842941) is [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine.
What is the SMILES notation for [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine?
The canonical SMILES for [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine is NC(=[NH2+])[NH3+].O=C(O)O.[H]N=C(N)N.
What is the InChIKey of [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine?
The InChIKey is STIAPHVBRDNOAJ-UHFFFAOYSA-P. The full InChI is InChI=1S/2CH5N3.CH2O3/c3*2-1(3)4/h2*(H5,2,3,4);(H2,2,3,4)/p+2.
What are the key properties of [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine?
[amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine has a molecular weight of 182.18 g/mol, XLogP of -4.64, 0 rotatable bonds, 8 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(azaniumylidene)methyl]azanium;carbonic acid;guanidine is sourced from PubChem (CID 170842941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).