About CID 170843740
CID 170843740 (PubChem CID 170843740) has the molecular formula C4H10MgO5
and a molecular weight of 162.42 g/mol.
Molecular Properties
| Compound Name | CID 170843740 |
| PubChem CID | 170843740 |
| Molecular Formula | C4H10MgO5 |
| Molecular Weight | 162.42 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | — |
| SMILES | COC(=O)OC(=O)OC.[H][H].[H][H].[Mg] |
| InChI | InChI=1S/C4H6O5.Mg.2H2/c1-7-3(5)9-4(6)8-2;;;/h1-2H3;;2*1H |
| InChIKey | NGZXOWRRRCROLZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 170843740 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170843740?
The IUPAC name of CID 170843740 (CID 170843740) is not available.
What is the SMILES notation for CID 170843740?
The canonical SMILES for CID 170843740 is COC(=O)OC(=O)OC.[H][H].[H][H].[Mg].
What is the InChIKey of CID 170843740?
The InChIKey is NGZXOWRRRCROLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.Mg.2H2/c1-7-3(5)9-4(6)8-2;;;/h1-2H3;;2*1H.
What are the key properties of CID 170843740?
CID 170843740 has a molecular weight of 162.42 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170843740 is sourced from PubChem (CID 170843740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).