About 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate
2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate (PubChem CID 170843989) has the molecular formula C6H15MoNO5
and a molecular weight of 277.13 g/mol. Its IUPAC name is 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate.
Molecular Properties
| Compound Name | 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate |
| PubChem CID | 170843989 |
| Molecular Formula | C6H15MoNO5 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate |
| SMILES | O.[Mo+4].[O-]CCN(CC[O-])CC[O-].[OH-] |
| InChI | InChI=1S/C6H12NO3.Mo.2H2O/c8-4-1-7(2-5-9)3-6-10;;;/h1-6H2;;2*1H2/q-3;+4;;/p-1 |
| InChIKey | PQYRYAPFDXMIFU-UHFFFAOYSA-M |
| XLogP | -4.63 |
| TPSA | 133.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate?
The IUPAC name of 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate (CID 170843989) is 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate.
What is the SMILES notation for 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate?
The canonical SMILES for 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate is O.[Mo+4].[O-]CCN(CC[O-])CC[O-].[OH-].
What is the InChIKey of 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate?
The InChIKey is PQYRYAPFDXMIFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12NO3.Mo.2H2O/c8-4-1-7(2-5-9)3-6-10;;;/h1-6H2;;2*1H2/q-3;+4;;/p-1.
What are the key properties of 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate?
2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate has a molecular weight of 277.13 g/mol, XLogP of -4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-oxidoethyl)amino]ethanolate;molybdenum(4+);hydroxide;hydrate is sourced from PubChem (CID 170843989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).