C20H18O9P2 — CID 170845243
[4-[1-(4-phosphonooxyphenyl)-3H-2-benzofuran-1-yl]phenyl] dihydrogen phosphate (PubChem CID 170845243) has the molecular formula C20H18O9P2 and a molecular weight of 464.30 g/mol. Its IUPAC name is [4-[1-(4-phosphonooxyphenyl)-3H-2-benzofuran-1-yl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[1-(4-phosphonooxyphenyl)-3H-2-benzofuran-1-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170845243 |
| Molecular Formula | C20H18O9P2 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | [4-[1-(4-phosphonooxyphenyl)-3H-2-benzofuran-1-yl]phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1ccc(C2(c3ccc(OP(=O)(O)O)cc3)OCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H18O9P2/c21-30(22,23)28-17-9-5-15(6-10-17)20(19-4-2-1-3-14(19)13-27-20)16-7-11-18(12-8-16)29-31(24,25)26/h1-12H,13H2,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | ZYLSXWSCHYHERQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|