C23H22K2N4O7S — CID 170845845
CID 170845845 (PubChem CID 170845845) has the molecular formula C23H22K2N4O7S and a molecular weight of 576.71 g/mol.
| Compound Name | CID 170845845 |
|---|---|
| PubChem CID | 170845845 |
| Molecular Formula | C23H22K2N4O7S |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | — |
| SMILES | CCN(/N=N/c1cc(C(=O)Nc2ccccc2)ccc1OC)c1ccc(S(=O)(=O)O)cc1C(=O)O.[K].[K] |
| InChI | InChI=1S/C23H22N4O7S.2K/c1-3-27(20-11-10-17(35(31,32)33)14-18(20)23(29)30)26-25-19-13-15(9-12-21(19)34-2)22(28)24-16-7-5-4-6-8-16;;/h4-14H,3H2,1-2H3,(H,24,28)(H,29,30)(H,31,32,33);;/b26-25+;; |
| InChIKey | MAYKECZORBYBNF-LHPVOXLHSA-N |
| XLogP | 3.66 |
| TPSA | 157.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|