C23H20K2N4O7S — CID 57354074
dipotassium;2-[(ethylideneamino)-[2-methoxy-5-(phenylcarbamoyl)anilino]amino]-5-sulfonatobenzoate (PubChem CID 57354074) has the molecular formula C23H20K2N4O7S and a molecular weight of 574.70 g/mol. Its IUPAC name is dipotassium;2-[(ethylideneamino)-[2-methoxy-5-(phenylcarbamoyl)anilino]amino]-5-sulfonatobenzoate.
| Compound Name | dipotassium;2-[(ethylideneamino)-[2-methoxy-5-(phenylcarbamoyl)anilino]amino]-5-sulfonatobenzoate |
|---|---|
| PubChem CID | 57354074 |
| Molecular Formula | C23H20K2N4O7S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | dipotassium;2-[(ethylideneamino)-[2-methoxy-5-(phenylcarbamoyl)anilino]amino]-5-sulfonatobenzoate |
| SMILES | CC=NN(Nc1cc(C(=O)Nc2ccccc2)ccc1OC)c1ccc(S(=O)(=O)[O-])cc1C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C23H22N4O7S.2K/c1-3-24-27(20-11-10-17(35(31,32)33)14-18(20)23(29)30)26-19-13-15(9-12-21(19)34-2)22(28)25-16-7-5-4-6-8-16;;/h3-14,26H,1-2H3,(H,25,28)(H,29,30)(H,31,32,33);;/q;2*+1/p-2 |
| InChIKey | HPYULQKKXADHFW-UHFFFAOYSA-L |
| XLogP | -3.94 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|