C17H20N4NaO5S — CID 170845215
CID 170845215 (PubChem CID 170845215) has the molecular formula C17H20N4NaO5S and a molecular weight of 415.43 g/mol.
| Compound Name | CID 170845215 |
|---|---|
| PubChem CID | 170845215 |
| Molecular Formula | C17H20N4NaO5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1/N=N/N(C)CCS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C17H20N4O5S.Na/c1-21(10-11-27(23,24)25)20-19-15-12-13(8-9-16(15)26-2)17(22)18-14-6-4-3-5-7-14;/h3-9,12H,10-11H2,1-2H3,(H,18,22)(H,23,24,25);/b20-19+; |
| InChIKey | LNZYXXFJMLUJJJ-RZLHGTIFSA-N |
| XLogP | 2.38 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|