C28H18N6Na2O9S2 — CID 170847401
disodium;4-[[(3E,5Z)-4,6-dioxo-3,5-bis(phenylhydrazinylidene)cyclohexen-1-yl]diazenyl]-5-oxido-7-sulfonaphthalene-2-sulfonate (PubChem CID 170847401) has the molecular formula C28H18N6Na2O9S2 and a molecular weight of 692.60 g/mol. Its IUPAC name is disodium;4-[[(3E,5Z)-4,6-dioxo-3,5-bis(phenylhydrazinylidene)cyclohexen-1-yl]diazenyl]-5-oxido-7-sulfonaphthalene-2-sulfonate.
| Compound Name | disodium;4-[[(3E,5Z)-4,6-dioxo-3,5-bis(phenylhydrazinylidene)cyclohexen-1-yl]diazenyl]-5-oxido-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 170847401 |
| Molecular Formula | C28H18N6Na2O9S2 |
| Molecular Weight | 692.60 g/mol |
| Exact Mass | 692.04 |
| IUPAC Name | disodium;4-[[(3E,5Z)-4,6-dioxo-3,5-bis(phenylhydrazinylidene)cyclohexen-1-yl]diazenyl]-5-oxido-7-sulfonaphthalene-2-sulfonate |
| SMILES | O=c1c(/N=N/c2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)O)cc([O-])c23)c/c(=N\Nc2ccccc2)c(=O)/c1=N\Nc1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C28H20N6O9S2.2Na/c35-24-14-20(45(41,42)43)12-16-11-19(44(38,39)40)13-21(25(16)24)31-33-23-15-22(32-29-17-7-3-1-4-8-17)27(36)26(28(23)37)34-30-18-9-5-2-6-10-18;;/h1-15,29-30,35H,(H,38,39,40)(H,41,42,43);;/q;2*+1/p-2/b32-22+,33-31+,34-26+;; |
| InChIKey | GSCMBINXMGBWCH-WCGHKERKSA-L |
| XLogP | -4.06 |
| TPSA | 242.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.60 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|