C24H14N8Na2O12S2 — CID 57354680
disodium;5-nitro-2-[[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxo-3-[(4-sulfonatophenyl)hydrazinylidene]cyclohexen-1-yl]diazenyl]benzenesulfonate (PubChem CID 57354680) has the molecular formula C24H14N8Na2O12S2 and a molecular weight of 716.53 g/mol. Its IUPAC name is disodium;5-nitro-2-[[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxo-3-[(4-sulfonatophenyl)hydrazinylidene]cyclohexen-1-yl]diazenyl]benzenesulfonate.
| Compound Name | disodium;5-nitro-2-[[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxo-3-[(4-sulfonatophenyl)hydrazinylidene]cyclohexen-1-yl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 57354680 |
| Molecular Formula | C24H14N8Na2O12S2 |
| Molecular Weight | 716.53 g/mol |
| Exact Mass | 716.00 |
| IUPAC Name | disodium;5-nitro-2-[[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxo-3-[(4-sulfonatophenyl)hydrazinylidene]cyclohexen-1-yl]diazenyl]benzenesulfonate |
| SMILES | O=c1c(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)[O-])cc(=NNc2ccc(S(=O)(=O)[O-])cc2)c(=O)c1=NNc1ccc([N+](=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C24H16N8O12S2.2Na/c33-23-19(28-25-14-3-8-17(9-4-14)45(39,40)41)12-20(24(34)22(23)30-26-13-1-5-15(6-2-13)31(35)36)29-27-18-10-7-16(32(37)38)11-21(18)46(42,43)44;;/h1-12,25-26H,(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/b28-19?,29-27+,30-22?;; |
| InChIKey | KEQBAHIZWUCDNL-JCAUIXAISA-L |
| XLogP | -4.81 |
| TPSA | 308.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.53 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|