C10H22N2S — CID 170848826
1,1-di(propan-2-yl)-3-propylthiourea (PubChem CID 170848826) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)-3-propylthiourea.
| Compound Name | 1,1-di(propan-2-yl)-3-propylthiourea |
|---|---|
| PubChem CID | 170848826 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,1-di(propan-2-yl)-3-propylthiourea |
| SMILES | CCCNC(=S)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2S/c1-6-7-11-10(13)12(8(2)3)9(4)5/h8-9H,6-7H2,1-5H3,(H,11,13) |
| InChIKey | ZLTZYURGKAXDTK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|