C40H24N2O12 — CID 170852208
4-(4-amino-2-methylphenyl)-3-methylaniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 170852208) has the molecular formula C40H24N2O12 and a molecular weight of 724.63 g/mol. Its IUPAC name is 4-(4-amino-2-methylphenyl)-3-methylaniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4-(4-amino-2-methylphenyl)-3-methylaniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 170852208 |
| Molecular Formula | C40H24N2O12 |
| Molecular Weight | 724.63 g/mol |
| Exact Mass | 724.13 |
| IUPAC Name | 4-(4-amino-2-methylphenyl)-3-methylaniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | Cc1cc(N)ccc1-c1ccc(N)cc1C.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21.O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C16H6O6.C14H16N2.C10H2O6/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2;11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-6H;3-8H,15-16H2,1-2H3;1-2H |
| InChIKey | ZKNNTWBHRIFPLZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 233.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|