C31H26N2O8 — CID 6452814
4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid;(1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 6452814) has the molecular formula C31H26N2O8 and a molecular weight of 554.56 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid;(1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid;(1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 6452814 |
| Molecular Formula | C31H26N2O8 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid;(1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H14N2.C9H4O5.C9H8O3/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-8H,9,14-15H2;1-3H,(H,10,11);1-2,4-7H,3H2/t;;4-,5+,6-,7+ |
| InChIKey | HRCKRBJBRGZFCN-PSHDLUJZSA-N |
| XLogP | 3.65 |
| TPSA | 176.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|