C30H24N2O11 — CID 6453358
1,3-dioxo-2-benzofuran-5-carboxylic acid;hexanedioic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene (PubChem CID 6453358) has the molecular formula C30H24N2O11 and a molecular weight of 588.53 g/mol. Its IUPAC name is 1,3-dioxo-2-benzofuran-5-carboxylic acid;hexanedioic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene.
| Compound Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;hexanedioic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
|---|---|
| PubChem CID | 6453358 |
| Molecular Formula | C30H24N2O11 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;hexanedioic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| SMILES | O=C(O)CCCCC(=O)O.O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C15H10N2O2.C9H4O5.C6H10O4/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;7-5(8)3-1-2-4-6(9)10/h1-8H,9H2;1-3H,(H,10,11);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | ORPOVDBLIWNXGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|