C22H18N2O5 — CID 170852100
4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid (PubChem CID 170852100) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid.
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 170852100 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carboxylic acid |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C13H14N2.C9H4O5/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-8H,9,14-15H2;1-3H,(H,10,11) |
| InChIKey | HSRJSUBAUTZYOA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|