C20H16N6O3 — CID 170856495
2-(4-methoxyphenyl)-2-[6-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]pyridazin-3-yl]acetonitrile (PubChem CID 170856495) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[6-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]pyridazin-3-yl]acetonitrile.
| Compound Name | 2-(4-methoxyphenyl)-2-[6-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]pyridazin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 170856495 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[6-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]pyridazin-3-yl]acetonitrile |
| SMILES | COc1ccc(C(C#N)c2ccc(N/N=C\c3ccc([N+](=O)[O-])cc3)nn2)cc1 |
| InChI | InChI=1S/C20H16N6O3/c1-29-17-8-4-15(5-9-17)18(12-21)19-10-11-20(25-23-19)24-22-13-14-2-6-16(7-3-14)26(27)28/h2-11,13,18H,1H3,(H,24,25)/b22-13- |
| InChIKey | KSIIQNJYQHOYMY-XKZIYDEJSA-N |
| XLogP | 3.49 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|