C24H22N4O10 — CID 170857959
(5-nitrofuran-2-yl)methyl N-[6-methoxy-3-(3,4,5-trimethoxybenzoyl)-2H-indazol-7-yl]carbamate (PubChem CID 170857959) has the molecular formula C24H22N4O10 and a molecular weight of 526.46 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)methyl N-[6-methoxy-3-(3,4,5-trimethoxybenzoyl)-2H-indazol-7-yl]carbamate.
| Compound Name | (5-nitrofuran-2-yl)methyl N-[6-methoxy-3-(3,4,5-trimethoxybenzoyl)-2H-indazol-7-yl]carbamate |
|---|---|
| PubChem CID | 170857959 |
| Molecular Formula | C24H22N4O10 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (5-nitrofuran-2-yl)methyl N-[6-methoxy-3-(3,4,5-trimethoxybenzoyl)-2H-indazol-7-yl]carbamate |
| SMILES | COc1cc(C(=O)c2[nH]nc3c(NC(=O)OCc4ccc([N+](=O)[O-])o4)c(OC)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O10/c1-33-15-7-6-14-19(21(15)25-24(30)37-11-13-5-8-18(38-13)28(31)32)26-27-20(14)22(29)12-9-16(34-2)23(36-4)17(10-12)35-3/h5-10H,11H2,1-4H3,(H,25,30)(H,26,27) |
| InChIKey | BXTCBEKGCRTVMJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|