C28H34N2O7 — CID 170858237
[6-[[3-(1H-indol-3-yl)-3-oxopropyl]amino]-5-methyl-6-oxohexyl] 3,4,5-trimethoxybenzoate (PubChem CID 170858237) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is [6-[[3-(1H-indol-3-yl)-3-oxopropyl]amino]-5-methyl-6-oxohexyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [6-[[3-(1H-indol-3-yl)-3-oxopropyl]amino]-5-methyl-6-oxohexyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 170858237 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [6-[[3-(1H-indol-3-yl)-3-oxopropyl]amino]-5-methyl-6-oxohexyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCCC(C)C(=O)NCCC(=O)c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C28H34N2O7/c1-18(27(32)29-13-12-23(31)21-17-30-22-11-6-5-10-20(21)22)9-7-8-14-37-28(33)19-15-24(34-2)26(36-4)25(16-19)35-3/h5-6,10-11,15-18,30H,7-9,12-14H2,1-4H3,(H,29,32) |
| InChIKey | MHDKJDGONIGBSJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|