C18H17N3O3S — CID 170858629
3-[[3-(1H-indazole-3-carbonylamino)phenyl]methylsulfanyl]propanoic acid (PubChem CID 170858629) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-[[3-(1H-indazole-3-carbonylamino)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-(1H-indazole-3-carbonylamino)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 170858629 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[[3-(1H-indazole-3-carbonylamino)phenyl]methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1cccc(NC(=O)c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C18H17N3O3S/c22-16(23)8-9-25-11-12-4-3-5-13(10-12)19-18(24)17-14-6-1-2-7-15(14)20-21-17/h1-7,10H,8-9,11H2,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | RQFBVVLEWXDAMG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|