C17H19N3O4 — CID 170860315
1-[4-(2-aminoacetyl)phenyl]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 170860315) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1-[4-(2-aminoacetyl)phenyl]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[4-(2-aminoacetyl)phenyl]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 170860315 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[4-(2-aminoacetyl)phenyl]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2ccc(C(=O)CN)cc2)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-23-13-7-8-16(24-2)14(9-13)20-17(22)19-12-5-3-11(4-6-12)15(21)10-18/h3-9H,10,18H2,1-2H3,(H2,19,20,22) |
| InChIKey | ICMIIDCYKPOBHO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |