C12H19Br2N3 — CID 170864182
1-[3-(4,5-dibromo-1H-pyrrol-2-yl)propyl]-4-methylpiperazine (PubChem CID 170864182) has the molecular formula C12H19Br2N3 and a molecular weight of 365.11 g/mol. Its IUPAC name is 1-[3-(4,5-dibromo-1H-pyrrol-2-yl)propyl]-4-methylpiperazine.
| Compound Name | 1-[3-(4,5-dibromo-1H-pyrrol-2-yl)propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170864182 |
| Molecular Formula | C12H19Br2N3 |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 1-[3-(4,5-dibromo-1H-pyrrol-2-yl)propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCc2cc(Br)c(Br)[nH]2)CC1 |
| InChI | InChI=1S/C12H19Br2N3/c1-16-5-7-17(8-6-16)4-2-3-10-9-11(13)12(14)15-10/h9,15H,2-8H2,1H3 |
| InChIKey | IOMPWPRHFNOKQF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |