C11H14Br2FN — CID 170865608
3-(3,6-dibromo-2-fluorophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170865608) has the molecular formula C11H14Br2FN and a molecular weight of 339.05 g/mol. Its IUPAC name is 3-(3,6-dibromo-2-fluorophenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3,6-dibromo-2-fluorophenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865608 |
| Molecular Formula | C11H14Br2FN |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 3-(3,6-dibromo-2-fluorophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1c(Br)ccc(Br)c1F |
| InChI | InChI=1S/C11H14Br2FN/c1-15(2)7-3-4-8-9(12)5-6-10(13)11(8)14/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | FWTKOLGASCQQDK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|