C11H13Br2F2N — CID 170866135
3-(3,6-dibromo-2,4-difluorophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866135) has the molecular formula C11H13Br2F2N and a molecular weight of 357.04 g/mol. Its IUPAC name is 3-(3,6-dibromo-2,4-difluorophenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3,6-dibromo-2,4-difluorophenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866135 |
| Molecular Formula | C11H13Br2F2N |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 3-(3,6-dibromo-2,4-difluorophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1c(Br)cc(F)c(Br)c1F |
| InChI | InChI=1S/C11H13Br2F2N/c1-16(2)5-3-4-7-8(12)6-9(14)10(13)11(7)15/h6H,3-5H2,1-2H3 |
| InChIKey | ZPAIFTLLBJFUBC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|