C10H13BrFNO — CID 84806968
N-[(3-bromo-5-fluoro-2,6-dimethylphenyl)methyl]-N-methylhydroxylamine (PubChem CID 84806968) has the molecular formula C10H13BrFNO and a molecular weight of 262.12 g/mol. Its IUPAC name is N-[(3-bromo-5-fluoro-2,6-dimethylphenyl)methyl]-N-methylhydroxylamine.
| Compound Name | N-[(3-bromo-5-fluoro-2,6-dimethylphenyl)methyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 84806968 |
| Molecular Formula | C10H13BrFNO |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | N-[(3-bromo-5-fluoro-2,6-dimethylphenyl)methyl]-N-methylhydroxylamine |
| SMILES | Cc1c(F)cc(Br)c(C)c1CN(C)O |
| InChI | InChI=1S/C10H13BrFNO/c1-6-8(5-13(3)14)7(2)10(12)4-9(6)11/h4,14H,5H2,1-3H3 |
| InChIKey | MSNYMNWFKKWKOX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|