C23H31N3O3 — CID 170865873
3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N,N-dimethylpropan-1-amine (PubChem CID 170865873) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865873 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccccc1C1CCN(c2ccc(CCCN(C)C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-24(2)14-6-7-18-10-11-21(22(17-18)26(27)28)25-15-12-19(13-16-25)20-8-4-5-9-23(20)29-3/h4-5,8-11,17,19H,6-7,12-16H2,1-3H3 |
| InChIKey | QIVVCZZIEMTEQB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|