C21H27N3O4 — CID 170875036
3-amino-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]propan-1-ol (PubChem CID 170875036) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-amino-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]propan-1-ol.
| Compound Name | 3-amino-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]propan-1-ol |
|---|---|
| PubChem CID | 170875036 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-amino-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]propan-1-ol |
| SMILES | COc1ccccc1C1CCN(c2ccc(C(N)CCO)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H27N3O4/c1-28-21-5-3-2-4-17(21)15-8-11-23(12-9-15)19-7-6-16(18(22)10-13-25)14-20(19)24(26)27/h2-7,14-15,18,25H,8-13,22H2,1H3 |
| InChIKey | XOCMLQWCNXKUSC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|