C30H33N3O4 — CID 6081278
(E)-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 6081278) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (E)-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6081278 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (E)-3-[4-[4-(2-methoxyphenyl)piperidin-1-yl]-3-nitrophenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | COc1ccccc1C1CCN(c2ccc(/C=C/C(=O)Nc3c(C)cc(C)cc3C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C30H33N3O4/c1-20-17-21(2)30(22(3)18-20)31-29(34)12-10-23-9-11-26(27(19-23)33(35)36)32-15-13-24(14-16-32)25-7-5-6-8-28(25)37-4/h5-12,17-19,24H,13-16H2,1-4H3,(H,31,34)/b12-10+ |
| InChIKey | KBQONRRZESEZJF-ZRDIBKRKSA-N |
| XLogP | 6.56 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|