C17H29ClN2 — CID 170866745
N,N-dimethyl-3-[4-(3-methylpiperidin-1-yl)phenyl]propan-1-amine;hydrochloride (PubChem CID 170866745) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(3-methylpiperidin-1-yl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-[4-(3-methylpiperidin-1-yl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 170866745 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N,N-dimethyl-3-[4-(3-methylpiperidin-1-yl)phenyl]propan-1-amine;hydrochloride |
| SMILES | CC1CCCN(c2ccc(CCCN(C)C)cc2)C1.Cl |
| InChI | InChI=1S/C17H28N2.ClH/c1-15-6-4-13-19(14-15)17-10-8-16(9-11-17)7-5-12-18(2)3;/h8-11,15H,4-7,12-14H2,1-3H3;1H |
| InChIKey | JZIRBQMYZBIFGA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|