C16H21ClN2 — CID 170866831
3-(2-chloro-8-ethylquinolin-3-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170866831) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 3-(2-chloro-8-ethylquinolin-3-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-chloro-8-ethylquinolin-3-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866831 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-(2-chloro-8-ethylquinolin-3-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CCc1cccc2cc(CCCN(C)C)c(Cl)nc12 |
| InChI | InChI=1S/C16H21ClN2/c1-4-12-7-5-8-13-11-14(9-6-10-19(2)3)16(17)18-15(12)13/h5,7-8,11H,4,6,9-10H2,1-3H3 |
| InChIKey | WOSDRJPLISGNPN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|