C9H14INO — CID 170867289
3-(5-iodofuran-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170867289) has the molecular formula C9H14INO and a molecular weight of 279.12 g/mol. Its IUPAC name is 3-(5-iodofuran-2-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-iodofuran-2-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170867289 |
| Molecular Formula | C9H14INO |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 3-(5-iodofuran-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc(I)o1 |
| InChI | InChI=1S/C9H14INO/c1-11(2)7-3-4-8-5-6-9(10)12-8/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | YFLBWOJXXPFXDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|