C17H25F3N2 — CID 170867728
3-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]propan-1-amine (PubChem CID 170867728) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 3-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 170867728 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(CCN2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C17H25F3N2/c18-17(19,20)16-7-11-22(12-8-16)10-6-15-4-1-3-14(13-15)5-2-9-21/h1,3-4,13,16H,2,5-12,21H2 |
| InChIKey | OGFOZAHEOLNBJA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |