C19H23F3N4S — CID 168619429
4-methyl-N-[[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619429) has the molecular formula C19H23F3N4S and a molecular weight of 396.48 g/mol. Its IUPAC name is 4-methyl-N-[[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619429 |
| Molecular Formula | C19H23F3N4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-methyl-N-[[3-[2-[4-(trifluoromethyl)piperidin-1-yl]ethyl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cccc(CCN3CCC(C(F)(F)F)CC3)c2)n1 |
| InChI | InChI=1S/C19H23F3N4S/c1-14-13-27-18(24-14)25-23-12-16-4-2-3-15(11-16)5-8-26-9-6-17(7-10-26)19(20,21)22/h2-4,11-13,17H,5-10H2,1H3,(H,24,25) |
| InChIKey | LVDCKUHYSGJACI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|