C12H16BrN3 — CID 170868928
3-(2-aminoethyl)-5-bromo-N,N-dimethyl-1H-indol-2-amine (PubChem CID 170868928) has the molecular formula C12H16BrN3 and a molecular weight of 282.19 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-bromo-N,N-dimethyl-1H-indol-2-amine.
| Compound Name | 3-(2-aminoethyl)-5-bromo-N,N-dimethyl-1H-indol-2-amine |
|---|---|
| PubChem CID | 170868928 |
| Molecular Formula | C12H16BrN3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-(2-aminoethyl)-5-bromo-N,N-dimethyl-1H-indol-2-amine |
| SMILES | CN(C)c1[nH]c2ccc(Br)cc2c1CCN |
| InChI | InChI=1S/C12H16BrN3/c1-16(2)12-9(5-6-14)10-7-8(13)3-4-11(10)15-12/h3-4,7,15H,5-6,14H2,1-2H3 |
| InChIKey | UBBJITOWBJCULT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |