C16H21ClN2O — CID 170871001
4-[3-(5-chloro-2-methyl-1H-indol-3-yl)propyl]morpholine (PubChem CID 170871001) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 4-[3-(5-chloro-2-methyl-1H-indol-3-yl)propyl]morpholine.
| Compound Name | 4-[3-(5-chloro-2-methyl-1H-indol-3-yl)propyl]morpholine |
|---|---|
| PubChem CID | 170871001 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-[3-(5-chloro-2-methyl-1H-indol-3-yl)propyl]morpholine |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CCCN1CCOCC1 |
| InChI | InChI=1S/C16H21ClN2O/c1-12-14(3-2-6-19-7-9-20-10-8-19)15-11-13(17)4-5-16(15)18-12/h4-5,11,18H,2-3,6-10H2,1H3 |
| InChIKey | OOLGZHOJSRNSQD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|