3-amino-2,3-di(thiophen-3-yl)propanoic acid

C11H11NO2S2 — CID 170871482

IUPAC3-amino-2,3-di(thiophen-3-yl)propanoic acid
SMILESNC(c1ccsc1)C(C(=O)O)c1ccsc1
InChIInChI=1S/C11H11NO2S2/c12-10(8-2-4-16-6-8)9(11(13)14)7-1-3-15-5-7/h1-6,9-10H,12H2,(H,13,14)
InChIKeyWKUQOIAMBDFAGM-UHFFFAOYSA-N
MW253.35 g/mol
LogP2.68
Rot. Bonds4

About 3-amino-2,3-di(thiophen-3-yl)propanoic acid

3-amino-2,3-di(thiophen-3-yl)propanoic acid (PubChem CID 170871482) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-amino-2,3-di(thiophen-3-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2,3-di(thiophen-3-yl)propanoic acid
PubChem CID170871482
Molecular FormulaC11H11NO2S2
Molecular Weight253.35 g/mol
Exact Mass253.02
IUPAC Name3-amino-2,3-di(thiophen-3-yl)propanoic acid
SMILESNC(c1ccsc1)C(C(=O)O)c1ccsc1
InChIInChI=1S/C11H11NO2S2/c12-10(8-2-4-16-6-8)9(11(13)14)7-1-3-15-5-7/h1-6,9-10H,12H2,(H,13,14)
InChIKeyWKUQOIAMBDFAGM-UHFFFAOYSA-N
XLogP2.68
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.35
LogP ≤ 52.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-amino-2,3-di(thiophen-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2,3-di(thiophen-3-yl)propanoic acid?
The IUPAC name of 3-amino-2,3-di(thiophen-3-yl)propanoic acid (CID 170871482) is 3-amino-2,3-di(thiophen-3-yl)propanoic acid.
What is the SMILES notation for 3-amino-2,3-di(thiophen-3-yl)propanoic acid?
The canonical SMILES for 3-amino-2,3-di(thiophen-3-yl)propanoic acid is NC(c1ccsc1)C(C(=O)O)c1ccsc1.
What is the InChIKey of 3-amino-2,3-di(thiophen-3-yl)propanoic acid?
The InChIKey is WKUQOIAMBDFAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S2/c12-10(8-2-4-16-6-8)9(11(13)14)7-1-3-15-5-7/h1-6,9-10H,12H2,(H,13,14).
What are the key properties of 3-amino-2,3-di(thiophen-3-yl)propanoic acid?
3-amino-2,3-di(thiophen-3-yl)propanoic acid has a molecular weight of 253.35 g/mol, XLogP of 2.68, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,3-di(thiophen-3-yl)propanoic acid is sourced from PubChem (CID 170871482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).