3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid

C13H17ClN2O5 — CID 170872869

IUPAC3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid
SMILESNC(CC(=O)O)C(Oc1ccc(Cl)cc1)C(N)CC(=O)O
InChIInChI=1S/C13H17ClN2O5/c14-7-1-3-8(4-2-7)21-13(9(15)5-11(17)18)10(16)6-12(19)20/h1-4,9-10,13H,5-6,15-16H2,(H,17,18)(H,19,20)
InChIKeyQSEHQKUHENUMGZ-UHFFFAOYSA-N
MW316.74 g/mol
LogP0.69
Rot. Bonds8

About 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid

3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid (PubChem CID 170872869) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid.

Molecular Properties

Compound Name3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid
PubChem CID170872869
Molecular FormulaC13H17ClN2O5
Molecular Weight316.74 g/mol
Exact Mass316.08
IUPAC Name3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid
SMILESNC(CC(=O)O)C(Oc1ccc(Cl)cc1)C(N)CC(=O)O
InChIInChI=1S/C13H17ClN2O5/c14-7-1-3-8(4-2-7)21-13(9(15)5-11(17)18)10(16)6-12(19)20/h1-4,9-10,13H,5-6,15-16H2,(H,17,18)(H,19,20)
InChIKeyQSEHQKUHENUMGZ-UHFFFAOYSA-N
XLogP0.69
TPSA135.87 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.74
LogP ≤ 50.69
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid?
The IUPAC name of 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid (CID 170872869) is 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid.
What is the SMILES notation for 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid?
The canonical SMILES for 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid is NC(CC(=O)O)C(Oc1ccc(Cl)cc1)C(N)CC(=O)O.
What is the InChIKey of 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid?
The InChIKey is QSEHQKUHENUMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O5/c14-7-1-3-8(4-2-7)21-13(9(15)5-11(17)18)10(16)6-12(19)20/h1-4,9-10,13H,5-6,15-16H2,(H,17,18)(H,19,20).
What are the key properties of 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid?
3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid has a molecular weight of 316.74 g/mol, XLogP of 0.69, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-4-(4-chlorophenoxy)heptanedioic acid is sourced from PubChem (CID 170872869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).