C17H14FNO2 — CID 170874045
3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)-1H-indole (PubChem CID 170874045) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)-1H-indole.
| Compound Name | 3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)-1H-indole |
|---|---|
| PubChem CID | 170874045 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-2-(4-fluorophenyl)-1H-indole |
| SMILES | Fc1ccc(-c2[nH]c3ccccc3c2C2OCCO2)cc1 |
| InChI | InChI=1S/C17H14FNO2/c18-12-7-5-11(6-8-12)16-15(17-20-9-10-21-17)13-3-1-2-4-14(13)19-16/h1-8,17,19H,9-10H2 |
| InChIKey | QHYCCVLOMSTDMX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |