C18H17BrClNO3 — CID 170875021
[5-(1-amino-3-hydroxypropyl)-1-benzofuran-2-yl]-(4-bromophenyl)methanone;hydrochloride (PubChem CID 170875021) has the molecular formula C18H17BrClNO3 and a molecular weight of 410.70 g/mol. Its IUPAC name is [5-(1-amino-3-hydroxypropyl)-1-benzofuran-2-yl]-(4-bromophenyl)methanone;hydrochloride.
| Compound Name | [5-(1-amino-3-hydroxypropyl)-1-benzofuran-2-yl]-(4-bromophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 170875021 |
| Molecular Formula | C18H17BrClNO3 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [5-(1-amino-3-hydroxypropyl)-1-benzofuran-2-yl]-(4-bromophenyl)methanone;hydrochloride |
| SMILES | Cl.NC(CCO)c1ccc2oc(C(=O)c3ccc(Br)cc3)cc2c1 |
| InChI | InChI=1S/C18H16BrNO3.ClH/c19-14-4-1-11(2-5-14)18(22)17-10-13-9-12(15(20)7-8-21)3-6-16(13)23-17;/h1-6,9-10,15,21H,7-8,20H2;1H |
| InChIKey | CBXJSSKVZSHWOK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |