C23H25NO4 — CID 170872757
3-amino-3-[2-(4-pentylbenzoyl)-1-benzofuran-5-yl]propanoic acid (PubChem CID 170872757) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-amino-3-[2-(4-pentylbenzoyl)-1-benzofuran-5-yl]propanoic acid.
| Compound Name | 3-amino-3-[2-(4-pentylbenzoyl)-1-benzofuran-5-yl]propanoic acid |
|---|---|
| PubChem CID | 170872757 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-amino-3-[2-(4-pentylbenzoyl)-1-benzofuran-5-yl]propanoic acid |
| SMILES | CCCCCc1ccc(C(=O)c2cc3cc(C(N)CC(=O)O)ccc3o2)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-2-3-4-5-15-6-8-16(9-7-15)23(27)21-13-18-12-17(10-11-20(18)28-21)19(24)14-22(25)26/h6-13,19H,2-5,14,24H2,1H3,(H,25,26) |
| InChIKey | UQXJVTXNUVAHQJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|