C13H22N2 — CID 66517020
(1R)-1-(4-pentylphenyl)ethane-1,2-diamine (PubChem CID 66517020) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (1R)-1-(4-pentylphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(4-pentylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517020 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (1R)-1-(4-pentylphenyl)ethane-1,2-diamine |
| SMILES | CCCCCc1ccc([C@@H](N)CN)cc1 |
| InChI | InChI=1S/C13H22N2/c1-2-3-4-5-11-6-8-12(9-7-11)13(15)10-14/h6-9,13H,2-5,10,14-15H2,1H3/t13-/m0/s1 |
| InChIKey | OYVZRDAUDZAJKR-ZDUSSCGKSA-N |
| XLogP | 2.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|