C19H33NO2 — CID 70232291
5-amino-5-(4-octylphenyl)pentane-1,3-diol (PubChem CID 70232291) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 5-amino-5-(4-octylphenyl)pentane-1,3-diol.
| Compound Name | 5-amino-5-(4-octylphenyl)pentane-1,3-diol |
|---|---|
| PubChem CID | 70232291 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 5-amino-5-(4-octylphenyl)pentane-1,3-diol |
| SMILES | CCCCCCCCc1ccc(C(N)CC(O)CCO)cc1 |
| InChI | InChI=1S/C19H33NO2/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)19(20)15-18(22)13-14-21/h9-12,18-19,21-22H,2-8,13-15,20H2,1H3 |
| InChIKey | VWIKBJCGIRALPZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|