C21H36N2O — CID 67621306
(3S)-3-[amino-(4-heptylphenyl)methyl]heptanamide (PubChem CID 67621306) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is (3S)-3-[amino-(4-heptylphenyl)methyl]heptanamide.
| Compound Name | (3S)-3-[amino-(4-heptylphenyl)methyl]heptanamide |
|---|---|
| PubChem CID | 67621306 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | (3S)-3-[amino-(4-heptylphenyl)methyl]heptanamide |
| SMILES | CCCCCCCc1ccc(C(N)[C@@H](CCCC)CC(N)=O)cc1 |
| InChI | InChI=1S/C21H36N2O/c1-3-5-7-8-9-10-17-12-14-18(15-13-17)21(23)19(11-6-4-2)16-20(22)24/h12-15,19,21H,3-11,16,23H2,1-2H3,(H2,22,24)/t19-,21?/m0/s1 |
| InChIKey | UCSISJNSZHCSBU-ZQRQZVKFSA-N |
| XLogP | 4.88 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|