C14H13F4NO2 — CID 170875053
3-amino-3-[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol (PubChem CID 170875053) has the molecular formula C14H13F4NO2 and a molecular weight of 303.26 g/mol. Its IUPAC name is 3-amino-3-[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol.
| Compound Name | 3-amino-3-[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 170875053 |
| Molecular Formula | C14H13F4NO2 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-amino-3-[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]propan-1-ol |
| SMILES | NC(CCO)c1ccc(-c2ccc(F)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C14H13F4NO2/c15-10-2-1-8(7-9(10)14(16,17)18)12-3-4-13(21-12)11(19)5-6-20/h1-4,7,11,20H,5-6,19H2 |
| InChIKey | VSQINDNSSGBJJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |