C15H13F4N3O2S — CID 87651925
1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea (PubChem CID 87651925) has the molecular formula C15H13F4N3O2S and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 87651925 |
| Molecular Formula | C15H13F4N3O2S |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea |
| SMILES | NC(=S)N(CCO)N=Cc1ccc(-c2ccc(F)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C15H13F4N3O2S/c16-12-3-1-9(7-11(12)15(17,18)19)13-4-2-10(24-13)8-21-22(5-6-23)14(20)25/h1-4,7-8,23H,5-6H2,(H2,20,25) |
| InChIKey | TUCGTDFLCKBAKJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|