C14H13Cl2N3O2S — CID 87653724
1-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea (PubChem CID 87653724) has the molecular formula C14H13Cl2N3O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is 1-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 87653724 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 1-[[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-(2-hydroxyethyl)thiourea |
| SMILES | NC(=S)N(CCO)N=Cc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C14H13Cl2N3O2S/c15-9-1-3-11(12(16)7-9)13-4-2-10(21-13)8-18-19(5-6-20)14(17)22/h1-4,7-8,20H,5-6H2,(H2,17,22) |
| InChIKey | OEOUGUFBPNPCBX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|