C16H15F4N3O2S — CID 76572681
1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-3-(2-methoxyethyl)thiourea (PubChem CID 76572681) has the molecular formula C16H15F4N3O2S and a molecular weight of 389.37 g/mol. Its IUPAC name is 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 76572681 |
| Molecular Formula | C16H15F4N3O2S |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 1-[[5-[4-fluoro-3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NN=Cc1ccc(-c2ccc(F)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H15F4N3O2S/c1-24-7-6-21-15(26)23-22-9-11-3-5-14(25-11)10-2-4-13(17)12(8-10)16(18,19)20/h2-5,8-9H,6-7H2,1H3,(H2,21,23,26) |
| InChIKey | YPIMCJHYRRIJGR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|