C18H20Cl2N4OS — CID 154432667
1-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-(2-pyrrolidin-1-ylethyl)thiourea (PubChem CID 154432667) has the molecular formula C18H20Cl2N4OS and a molecular weight of 411.36 g/mol. Its IUPAC name is 1-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-(2-pyrrolidin-1-ylethyl)thiourea.
| Compound Name | 1-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-(2-pyrrolidin-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 154432667 |
| Molecular Formula | C18H20Cl2N4OS |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-(2-pyrrolidin-1-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCCC1)NN=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H20Cl2N4OS/c19-15-5-3-13(11-16(15)20)17-6-4-14(25-17)12-22-23-18(26)21-7-10-24-8-1-2-9-24/h3-6,11-12H,1-2,7-10H2,(H2,21,23,26) |
| InChIKey | JFFLXAPJBOYWER-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|