C18H17Cl2N3O4 — CID 94837428
N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide (PubChem CID 94837428) has the molecular formula C18H17Cl2N3O4 and a molecular weight of 410.26 g/mol. Its IUPAC name is N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 94837428 |
| Molecular Formula | C18H17Cl2N3O4 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-[[(2S)-oxolan-2-yl]methyl]oxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)C(=O)N/N=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H17Cl2N3O4/c19-14-5-3-11(8-15(14)20)16-6-4-13(27-16)10-22-23-18(25)17(24)21-9-12-2-1-7-26-12/h3-6,8,10,12H,1-2,7,9H2,(H,21,24)(H,23,25)/b22-10+/t12-/m0/s1 |
| InChIKey | XQDTVGCQJNIKRR-PGCIDKTFSA-N |
| XLogP | 3.00 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|