C14H19NO7 — CID 170880308
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid (PubChem CID 170880308) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 170880308 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4-trihydroxyphenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(O)c(O)c1O)C(=O)O |
| InChI | InChI=1S/C14H19NO7/c1-14(2,3)22-13(21)15-8(12(19)20)6-7-4-5-9(16)11(18)10(7)17/h4-5,8,16-18H,6H2,1-3H3,(H,15,21)(H,19,20) |
| InChIKey | UCDCYWDGMRPJPC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|