C14H20BNO7 — CID 171444373
(2S)-3-(3-borono-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 171444373) has the molecular formula C14H20BNO7 and a molecular weight of 325.13 g/mol. Its IUPAC name is (2S)-3-(3-borono-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(3-borono-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 171444373 |
| Molecular Formula | C14H20BNO7 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2S)-3-(3-borono-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(B(O)O)c1O)C(=O)O |
| InChI | InChI=1S/C14H20BNO7/c1-14(2,3)23-13(20)16-10(12(18)19)7-8-5-4-6-9(11(8)17)15(21)22/h4-6,10,17,21-22H,7H2,1-3H3,(H,16,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | VNJJJDSQRAIMRC-JTQLQIEISA-N |
| XLogP | -0.41 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|